C37H37NO2S3 — CID 123817498
(3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-8-tritylsulfanyloct-4-en-1-one (PubChem CID 123817498) has the molecular formula C37H37NO2S3 and a molecular weight of 623.91 g/mol. Its IUPAC name is (3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-8-tritylsulfanyloct-4-en-1-one.
| Compound Name | (3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-8-tritylsulfanyloct-4-en-1-one |
|---|---|
| PubChem CID | 123817498 |
| Molecular Formula | C37H37NO2S3 |
| Molecular Weight | 623.91 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | (3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-8-tritylsulfanyloct-4-en-1-one |
| SMILES | O=C(C[C@H](O)C=CCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)N1C(=S)SC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C37H37NO2S3/c39-34(27-35(40)38-33(28-42-36(38)41)26-29-16-6-1-7-17-29)24-14-5-15-25-43-37(30-18-8-2-9-19-30,31-20-10-3-11-21-31)32-22-12-4-13-23-32/h1-4,6-14,16-24,33-34,39H,5,15,25-28H2/t33-,34-/m1/s1 |
| InChIKey | LNEYZTXSRNORJZ-KKLWWLSJSA-N |
| XLogP | 8.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.91 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|