C20H21NOS2 — CID 87466806
1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-phenylbutan-1-one (PubChem CID 87466806) has the molecular formula C20H21NOS2 and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 87466806 |
| Molecular Formula | C20H21NOS2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-phenylbutan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H21NOS2/c22-19(13-7-12-16-8-3-1-4-9-16)21-18(15-24-20(21)23)14-17-10-5-2-6-11-17/h1-6,8-11,18H,7,12-15H2/t18-/m0/s1 |
| InChIKey | PAFVKDRJXASKEG-SFHVURJKSA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|