C17H20ClNO2S2 — CID 154339650
(3R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-chloro-3-hydroxyhept-4-en-1-one (PubChem CID 154339650) has the molecular formula C17H20ClNO2S2 and a molecular weight of 369.94 g/mol. Its IUPAC name is (3R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-chloro-3-hydroxyhept-4-en-1-one.
| Compound Name | (3R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-chloro-3-hydroxyhept-4-en-1-one |
|---|---|
| PubChem CID | 154339650 |
| Molecular Formula | C17H20ClNO2S2 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | (3R)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-chloro-3-hydroxyhept-4-en-1-one |
| SMILES | O=C(C[C@@H](O)C=CCCCl)N1C(=S)SC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H20ClNO2S2/c18-9-5-4-8-15(20)11-16(21)19-14(12-23-17(19)22)10-13-6-2-1-3-7-13/h1-4,6-8,14-15,20H,5,9-12H2/t14-,15+/m1/s1 |
| InChIKey | OXEQMHCCZQXLPJ-CABCVRRESA-N |
| XLogP | 3.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|