C27H37ClN2O5S2 — CID 118542646
[(E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-chloro-1-oxohept-4-en-3-yl] 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 118542646) has the molecular formula C27H37ClN2O5S2 and a molecular weight of 569.19 g/mol. Its IUPAC name is [(E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-chloro-1-oxohept-4-en-3-yl] 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [(E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-chloro-1-oxohept-4-en-3-yl] 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 118542646 |
| Molecular Formula | C27H37ClN2O5S2 |
| Molecular Weight | 569.19 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | [(E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-7-chloro-1-oxohept-4-en-3-yl] 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)O[C@H](/C=C/CCCl)CC(=O)N1C(=S)SC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H37ClN2O5S2/c1-18(2)23(29-25(33)35-27(3,4)5)24(32)34-21(13-9-10-14-28)16-22(31)30-20(17-37-26(30)36)15-19-11-7-6-8-12-19/h6-9,11-13,18,20-21,23H,10,14-17H2,1-5H3,(H,29,33)/b13-9+/t20-,21-,23?/m1/s1 |
| InChIKey | JVDIXAXSLFSVBD-HOJHBISJSA-N |
| XLogP | 5.49 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.19 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|