C21H27NO4S2 — CID 25001339
[(Z,6S)-8-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-hydroxy-3-methyl-8-oxooct-2-enyl] acetate (PubChem CID 25001339) has the molecular formula C21H27NO4S2 and a molecular weight of 421.58 g/mol. Its IUPAC name is [(Z,6S)-8-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-hydroxy-3-methyl-8-oxooct-2-enyl] acetate.
| Compound Name | [(Z,6S)-8-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-hydroxy-3-methyl-8-oxooct-2-enyl] acetate |
|---|---|
| PubChem CID | 25001339 |
| Molecular Formula | C21H27NO4S2 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [(Z,6S)-8-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-6-hydroxy-3-methyl-8-oxooct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(/C)CC[C@H](O)CC(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H27NO4S2/c1-15(10-11-26-16(2)23)8-9-19(24)13-20(25)22-18(14-28-21(22)27)12-17-6-4-3-5-7-17/h3-7,10,18-19,24H,8-9,11-14H2,1-2H3/b15-10-/t18-,19-/m0/s1 |
| InChIKey | BGQPXYANAGZMAI-WMVUTUSMSA-N |
| XLogP | 3.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|