C26H25NO2S2 — CID 135054585
(2R,3S)-2-benzyl-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-3-phenylpropan-1-one (PubChem CID 135054585) has the molecular formula C26H25NO2S2 and a molecular weight of 447.62 g/mol. Its IUPAC name is (2R,3S)-2-benzyl-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-3-phenylpropan-1-one.
| Compound Name | (2R,3S)-2-benzyl-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 135054585 |
| Molecular Formula | C26H25NO2S2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (2R,3S)-2-benzyl-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-3-phenylpropan-1-one |
| SMILES | O=C([C@H](Cc1ccccc1)[C@H](O)c1ccccc1)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H25NO2S2/c28-24(21-14-8-3-9-15-21)23(17-20-12-6-2-7-13-20)25(29)27-22(18-31-26(27)30)16-19-10-4-1-5-11-19/h1-15,22-24,28H,16-18H2/t22-,23+,24+/m0/s1 |
| InChIKey | NSHSSESAOJMDEJ-RBZQAINGSA-N |
| XLogP | 5.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|