C30H39NO4S2Si — CID 91562277
(4R,5S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidine-3-carbonyl]-4-[tert-butyl(dimethyl)silyl]oxy-7-phenylhept-2-enoic acid (PubChem CID 91562277) has the molecular formula C30H39NO4S2Si and a molecular weight of 569.87 g/mol. Its IUPAC name is (4R,5S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidine-3-carbonyl]-4-[tert-butyl(dimethyl)silyl]oxy-7-phenylhept-2-enoic acid.
| Compound Name | (4R,5S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidine-3-carbonyl]-4-[tert-butyl(dimethyl)silyl]oxy-7-phenylhept-2-enoic acid |
|---|---|
| PubChem CID | 91562277 |
| Molecular Formula | C30H39NO4S2Si |
| Molecular Weight | 569.87 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | (4R,5S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidine-3-carbonyl]-4-[tert-butyl(dimethyl)silyl]oxy-7-phenylhept-2-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C=CC(=O)O)[C@H](CCc1ccccc1)C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C30H39NO4S2Si/c1-30(2,3)38(4,5)35-26(18-19-27(32)33)25(17-16-22-12-8-6-9-13-22)28(34)31-24(21-37-29(31)36)20-23-14-10-7-11-15-23/h6-15,18-19,24-26H,16-17,20-21H2,1-5H3,(H,32,33)/t24-,25-,26+/m0/s1 |
| InChIKey | BELISGWBHCZXSD-KKUQBAQOSA-N |
| XLogP | 6.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.87 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|