C16H25NO2S4 — CID 159948001
(3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxyhexan-1-one;sulfane (PubChem CID 159948001) has the molecular formula C16H25NO2S4 and a molecular weight of 391.65 g/mol. Its IUPAC name is (3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxyhexan-1-one;sulfane.
| Compound Name | (3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxyhexan-1-one;sulfane |
|---|---|
| PubChem CID | 159948001 |
| Molecular Formula | C16H25NO2S4 |
| Molecular Weight | 391.65 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (3S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxyhexan-1-one;sulfane |
| SMILES | CCC[C@H](O)CC(=O)N1C(=S)SC[C@@H]1Cc1ccccc1.S.S |
| InChI | InChI=1S/C16H21NO2S2.2H2S/c1-2-6-14(18)10-15(19)17-13(11-21-16(17)20)9-12-7-4-3-5-8-12;;/h3-5,7-8,13-14,18H,2,6,9-11H2,1H3;2*1H2/t13-,14-;;/m0../s1 |
| InChIKey | OBSSPRBYMUCJRQ-AXEKQOJOSA-N |
| XLogP | 3.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.65 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|