C18H23NO2S2 — CID 89089425
(E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxyoct-4-en-1-one (PubChem CID 89089425) has the molecular formula C18H23NO2S2 and a molecular weight of 349.52 g/mol. Its IUPAC name is (E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxyoct-4-en-1-one.
| Compound Name | (E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxyoct-4-en-1-one |
|---|---|
| PubChem CID | 89089425 |
| Molecular Formula | C18H23NO2S2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (E,3S)-1-[(4R)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxyoct-4-en-1-one |
| SMILES | CCC/C=C/[C@@H](O)CC(=O)N1C(=S)SC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H23NO2S2/c1-2-3-5-10-16(20)12-17(21)19-15(13-23-18(19)22)11-14-8-6-4-7-9-14/h4-10,15-16,20H,2-3,11-13H2,1H3/b10-5+/t15-,16-/m1/s1 |
| InChIKey | YFMCKCFQWRBTQH-CKOVFFODSA-N |
| XLogP | 3.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|