C30H39NO3S4 — CID 11410741
(2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-[2-(2-methyl-1,3-dithiolan-2-yl)ethyl]-7-phenylmethoxyheptan-1-one (PubChem CID 11410741) has the molecular formula C30H39NO3S4 and a molecular weight of 589.91 g/mol. Its IUPAC name is (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-[2-(2-methyl-1,3-dithiolan-2-yl)ethyl]-7-phenylmethoxyheptan-1-one.
| Compound Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-[2-(2-methyl-1,3-dithiolan-2-yl)ethyl]-7-phenylmethoxyheptan-1-one |
|---|---|
| PubChem CID | 11410741 |
| Molecular Formula | C30H39NO3S4 |
| Molecular Weight | 589.91 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxy-2-[2-(2-methyl-1,3-dithiolan-2-yl)ethyl]-7-phenylmethoxyheptan-1-one |
| SMILES | CC1(CC[C@H](C(=O)N2C(=S)SC[C@@H]2Cc2ccccc2)[C@H](O)CCCCOCc2ccccc2)SCCS1 |
| InChI | InChI=1S/C30H39NO3S4/c1-30(37-18-19-38-30)16-15-26(27(32)14-8-9-17-34-21-24-12-6-3-7-13-24)28(33)31-25(22-36-29(31)35)20-23-10-4-2-5-11-23/h2-7,10-13,25-27,32H,8-9,14-22H2,1H3/t25-,26-,27+/m0/s1 |
| InChIKey | PMXPBTPUGXKPSO-GMQQYTKMSA-N |
| XLogP | 6.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.91 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|