C61H69N3O6S2 — CID 157364672
oxolane;N-prop-2-ynyl-5-(3-tritylsulfanylpropanoylamino)pentanamide;5-(3-tritylsulfanylpropanoylamino)pentanoic acid (PubChem CID 157364672) has the molecular formula C61H69N3O6S2 and a molecular weight of 1004.37 g/mol. Its IUPAC name is oxolane;N-prop-2-ynyl-5-(3-tritylsulfanylpropanoylamino)pentanamide;5-(3-tritylsulfanylpropanoylamino)pentanoic acid.
| Compound Name | oxolane;N-prop-2-ynyl-5-(3-tritylsulfanylpropanoylamino)pentanamide;5-(3-tritylsulfanylpropanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 157364672 |
| Molecular Formula | C61H69N3O6S2 |
| Molecular Weight | 1004.37 g/mol |
| Exact Mass | 1003.46 |
| IUPAC Name | oxolane;N-prop-2-ynyl-5-(3-tritylsulfanylpropanoylamino)pentanamide;5-(3-tritylsulfanylpropanoylamino)pentanoic acid |
| SMILES | C#CCNC(=O)CCCCNC(=O)CCSC(c1ccccc1)(c1ccccc1)c1ccccc1.C1CCOC1.O=C(O)CCCCNC(=O)CCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O2S.C27H29NO3S.C4H8O/c1-2-22-31-28(33)20-12-13-23-32-29(34)21-24-35-30(25-14-6-3-7-15-25,26-16-8-4-9-17-26)27-18-10-5-11-19-27;29-25(28-20-11-10-18-26(30)31)19-21-32-27(22-12-4-1-5-13-22,23-14-6-2-7-15-23)24-16-8-3-9-17-24;1-2-4-5-3-1/h1,3-11,14-19H,12-13,20-24H2,(H,31,33)(H,32,34);1-9,12-17H,10-11,18-21H2,(H,28,29)(H,30,31);1-4H2 |
| InChIKey | BJARZTQCNRSFCJ-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.37 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|