C36H44N2O7S — CID 70809582
(2R)-2-[bis(2-acetyloxyethyl)amino]-6-(3-tritylsulfanylpropanoylamino)hexanoic acid (PubChem CID 70809582) has the molecular formula C36H44N2O7S and a molecular weight of 648.82 g/mol. Its IUPAC name is (2R)-2-[bis(2-acetyloxyethyl)amino]-6-(3-tritylsulfanylpropanoylamino)hexanoic acid.
| Compound Name | (2R)-2-[bis(2-acetyloxyethyl)amino]-6-(3-tritylsulfanylpropanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 70809582 |
| Molecular Formula | C36H44N2O7S |
| Molecular Weight | 648.82 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | (2R)-2-[bis(2-acetyloxyethyl)amino]-6-(3-tritylsulfanylpropanoylamino)hexanoic acid |
| SMILES | CC(=O)OCCN(CCOC(C)=O)[C@H](CCCCNC(=O)CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C36H44N2O7S/c1-28(39)44-25-23-38(24-26-45-29(2)40)33(35(42)43)20-12-13-22-37-34(41)21-27-46-36(30-14-6-3-7-15-30,31-16-8-4-9-17-31)32-18-10-5-11-19-32/h3-11,14-19,33H,12-13,20-27H2,1-2H3,(H,37,41)(H,42,43)/t33-/m1/s1 |
| InChIKey | MDDCDWFKXZVPFC-MGBGTMOVSA-N |
| XLogP | 5.27 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.82 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|