C28H30N2O4S2 — CID 10625854
(2R)-3-benzylsulfanyl-2-[[(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]propanoyl]amino]propanoic acid (PubChem CID 10625854) has the molecular formula C28H30N2O4S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is (2R)-3-benzylsulfanyl-2-[[(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]propanoyl]amino]propanoic acid.
| Compound Name | (2R)-3-benzylsulfanyl-2-[[(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10625854 |
| Molecular Formula | C28H30N2O4S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | (2R)-3-benzylsulfanyl-2-[[(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]propanoyl]amino]propanoic acid |
| SMILES | O=C(O)[C@H](CSCc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](S)Cc1ccccc1 |
| InChI | InChI=1S/C28H30N2O4S2/c31-26(30-24(28(33)34)19-36-18-22-14-8-3-9-15-22)23(16-20-10-4-1-5-11-20)29-27(32)25(35)17-21-12-6-2-7-13-21/h1-15,23-25,35H,16-19H2,(H,29,32)(H,30,31)(H,33,34)/t23-,24-,25-/m0/s1 |
| InChIKey | GOLABEZEQYPTTR-SDHOMARFSA-N |
| XLogP | 3.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|