C26H26N2O6S — CID 58697721
(3S)-4-[[(1S)-1-carboxy-2-naphthalen-2-ylethyl]amino]-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]butanoic acid (PubChem CID 58697721) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is (3S)-4-[[(1S)-1-carboxy-2-naphthalen-2-ylethyl]amino]-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]butanoic acid.
| Compound Name | (3S)-4-[[(1S)-1-carboxy-2-naphthalen-2-ylethyl]amino]-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 58697721 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (3S)-4-[[(1S)-1-carboxy-2-naphthalen-2-ylethyl]amino]-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]butanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)[C@@H](S)Cc1ccccc1)C(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C26H26N2O6S/c29-23(30)15-20(27-25(32)22(35)14-16-6-2-1-3-7-16)24(31)28-21(26(33)34)13-17-10-11-18-8-4-5-9-19(18)12-17/h1-12,20-22,35H,13-15H2,(H,27,32)(H,28,31)(H,29,30)(H,33,34)/t20-,21-,22-/m0/s1 |
| InChIKey | BXQIHLQJSNXBAF-FKBYEOEOSA-N |
| XLogP | 2.45 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|