C24H25N3O6S — CID 142902891
4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]butanoic acid (PubChem CID 142902891) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is 4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]butanoic acid.
| Compound Name | 4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 142902891 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxo-3-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]butanoic acid |
| SMILES | O=C(O)CC(NC(=O)[C@@H](S)Cc1ccccc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C24H25N3O6S/c28-21(29)12-18(26-23(31)20(34)10-14-6-2-1-3-7-14)22(30)27-19(24(32)33)11-15-13-25-17-9-5-4-8-16(15)17/h1-9,13,18-20,25,34H,10-12H2,(H,26,31)(H,27,30)(H,28,29)(H,32,33)/t18?,19?,20-/m0/s1 |
| InChIKey | FTWXREZNZQDLND-MHJFOBGBSA-N |
| XLogP | 1.78 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|