C26H26N4O6S — CID 10006967
4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-[[3-(1H-indol-3-yl)-2-sulfanylpropanoyl]amino]-4-oxobutanoic acid (PubChem CID 10006967) has the molecular formula C26H26N4O6S and a molecular weight of 522.58 g/mol. Its IUPAC name is 4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-[[3-(1H-indol-3-yl)-2-sulfanylpropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-[[3-(1H-indol-3-yl)-2-sulfanylpropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10006967 |
| Molecular Formula | C26H26N4O6S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-[[3-(1H-indol-3-yl)-2-sulfanylpropanoyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CC(NC(=O)C(S)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H26N4O6S/c31-23(32)11-20(29-25(34)22(37)10-15-13-28-19-8-4-2-6-17(15)19)24(33)30-21(26(35)36)9-14-12-27-18-7-3-1-5-16(14)18/h1-8,12-13,20-22,27-28,37H,9-11H2,(H,29,34)(H,30,33)(H,31,32)(H,35,36) |
| InChIKey | BIWUREJQPMAOPV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|