C25H27N3O7S — CID 87908245
4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-[[3-(2-methoxyphenyl)-2-sulfanylpropanoyl]amino]-4-oxobutanoic acid (PubChem CID 87908245) has the molecular formula C25H27N3O7S and a molecular weight of 513.57 g/mol. Its IUPAC name is 4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-[[3-(2-methoxyphenyl)-2-sulfanylpropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-[[3-(2-methoxyphenyl)-2-sulfanylpropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87908245 |
| Molecular Formula | C25H27N3O7S |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-[[3-(2-methoxyphenyl)-2-sulfanylpropanoyl]amino]-4-oxobutanoic acid |
| SMILES | COc1ccccc1CC(S)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H27N3O7S/c1-35-20-9-5-2-6-14(20)11-21(36)24(32)27-18(12-22(29)30)23(31)28-19(25(33)34)10-15-13-26-17-8-4-3-7-16(15)17/h2-9,13,18-19,21,26,36H,10-12H2,1H3,(H,27,32)(H,28,31)(H,29,30)(H,33,34) |
| InChIKey | SBYQHWRNBWNLPP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 157.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|