C24H26N2O5 — CID 161392027
5-[[(1S)-1-carboxy-2-phenylethyl]amino]-5-oxopentanoic acid;naphthalen-2-amine (PubChem CID 161392027) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 5-[[(1S)-1-carboxy-2-phenylethyl]amino]-5-oxopentanoic acid;naphthalen-2-amine.
| Compound Name | 5-[[(1S)-1-carboxy-2-phenylethyl]amino]-5-oxopentanoic acid;naphthalen-2-amine |
|---|---|
| PubChem CID | 161392027 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 5-[[(1S)-1-carboxy-2-phenylethyl]amino]-5-oxopentanoic acid;naphthalen-2-amine |
| SMILES | Nc1ccc2ccccc2c1.O=C(O)CCCC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H17NO5.C10H9N/c16-12(7-4-8-13(17)18)15-11(14(19)20)9-10-5-2-1-3-6-10;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-3,5-6,11H,4,7-9H2,(H,15,16)(H,17,18)(H,19,20);1-7H,11H2/t11-;/m0./s1 |
| InChIKey | VTCNFRGJLVYNSU-MERQFXBCSA-N |
| XLogP | 3.48 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|