C40H53N5O7S — CID 71533816
2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-(5-tritylsulfanylpentylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 71533816) has the molecular formula C40H53N5O7S and a molecular weight of 747.96 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-(5-tritylsulfanylpentylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-(5-tritylsulfanylpentylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 71533816 |
| Molecular Formula | C40H53N5O7S |
| Molecular Weight | 747.96 g/mol |
| Exact Mass | 747.37 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-(5-tritylsulfanylpentylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)NCCCCCSC(c2ccccc2)(c2ccccc2)c2ccccc2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C40H53N5O7S/c46-36(29-42-20-22-43(30-37(47)48)24-26-45(32-39(51)52)27-25-44(23-21-42)31-38(49)50)41-19-11-4-12-28-53-40(33-13-5-1-6-14-33,34-15-7-2-8-16-34)35-17-9-3-10-18-35/h1-3,5-10,13-18H,4,11-12,19-32H2,(H,41,46)(H,47,48)(H,49,50)(H,51,52) |
| InChIKey | YXHJQLZXWZANNF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.96 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|