C25H28N2OS2 — CID 89114679
N-(2-sulfanylethyl)-2-(2-tritylsulfanylethylamino)acetamide (PubChem CID 89114679) has the molecular formula C25H28N2OS2 and a molecular weight of 436.65 g/mol. Its IUPAC name is N-(2-sulfanylethyl)-2-(2-tritylsulfanylethylamino)acetamide.
| Compound Name | N-(2-sulfanylethyl)-2-(2-tritylsulfanylethylamino)acetamide |
|---|---|
| PubChem CID | 89114679 |
| Molecular Formula | C25H28N2OS2 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-(2-sulfanylethyl)-2-(2-tritylsulfanylethylamino)acetamide |
| SMILES | O=C(CNCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)NCCS |
| InChI | InChI=1S/C25H28N2OS2/c28-24(27-16-18-29)20-26-17-19-30-25(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,26,29H,16-20H2,(H,27,28) |
| InChIKey | SOPFTANJJWPSCS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|