C27H31BrN2OS — CID 89114615
2-[bromomethyl(propyl)amino]-N-(2-tritylsulfanylethyl)acetamide (PubChem CID 89114615) has the molecular formula C27H31BrN2OS and a molecular weight of 511.53 g/mol. Its IUPAC name is 2-[bromomethyl(propyl)amino]-N-(2-tritylsulfanylethyl)acetamide.
| Compound Name | 2-[bromomethyl(propyl)amino]-N-(2-tritylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 89114615 |
| Molecular Formula | C27H31BrN2OS |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 2-[bromomethyl(propyl)amino]-N-(2-tritylsulfanylethyl)acetamide |
| SMILES | CCCN(CBr)CC(=O)NCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31BrN2OS/c1-2-19-30(22-28)21-26(31)29-18-20-32-27(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17H,2,18-22H2,1H3,(H,29,31) |
| InChIKey | HIALBFANMNWMSI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|