C34H45N3OS — CID 70935247
N-[2-[3-piperidin-1-ylpropyl(propyl)amino]ethyl]-2-tritylsulfanylacetamide (PubChem CID 70935247) has the molecular formula C34H45N3OS and a molecular weight of 543.82 g/mol. Its IUPAC name is N-[2-[3-piperidin-1-ylpropyl(propyl)amino]ethyl]-2-tritylsulfanylacetamide.
| Compound Name | N-[2-[3-piperidin-1-ylpropyl(propyl)amino]ethyl]-2-tritylsulfanylacetamide |
|---|---|
| PubChem CID | 70935247 |
| Molecular Formula | C34H45N3OS |
| Molecular Weight | 543.82 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | N-[2-[3-piperidin-1-ylpropyl(propyl)amino]ethyl]-2-tritylsulfanylacetamide |
| SMILES | CCCN(CCCN1CCCCC1)CCNC(=O)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H45N3OS/c1-2-23-36(26-15-27-37-24-13-6-14-25-37)28-22-35-33(38)29-39-34(30-16-7-3-8-17-30,31-18-9-4-10-19-31)32-20-11-5-12-21-32/h3-5,7-12,16-21H,2,6,13-15,22-29H2,1H3,(H,35,38) |
| InChIKey | NBODERYHRVBVHG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.82 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|