C33H43N3O2S — CID 70935246
N-[2-[3-morpholin-4-ylpropyl(propyl)amino]ethyl]-2-tritylsulfanylacetamide (PubChem CID 70935246) has the molecular formula C33H43N3O2S and a molecular weight of 545.79 g/mol. Its IUPAC name is N-[2-[3-morpholin-4-ylpropyl(propyl)amino]ethyl]-2-tritylsulfanylacetamide.
| Compound Name | N-[2-[3-morpholin-4-ylpropyl(propyl)amino]ethyl]-2-tritylsulfanylacetamide |
|---|---|
| PubChem CID | 70935246 |
| Molecular Formula | C33H43N3O2S |
| Molecular Weight | 545.79 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | N-[2-[3-morpholin-4-ylpropyl(propyl)amino]ethyl]-2-tritylsulfanylacetamide |
| SMILES | CCCN(CCCN1CCOCC1)CCNC(=O)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H43N3O2S/c1-2-20-35(21-12-22-36-24-26-38-27-25-36)23-19-34-32(37)28-39-33(29-13-6-3-7-14-29,30-15-8-4-9-16-30)31-17-10-5-11-18-31/h3-11,13-18H,2,12,19-28H2,1H3,(H,34,37) |
| InChIKey | BHVGIRBNPKVITO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.79 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|