C17H25N3O3 — CID 108944050
N'-ethyl-N-(2-morpholin-4-ylethyl)-N'-phenylpropanediamide (PubChem CID 108944050) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is N'-ethyl-N-(2-morpholin-4-ylethyl)-N'-phenylpropanediamide.
| Compound Name | N'-ethyl-N-(2-morpholin-4-ylethyl)-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 108944050 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N'-ethyl-N-(2-morpholin-4-ylethyl)-N'-phenylpropanediamide |
| SMILES | CCN(C(=O)CC(=O)NCCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C17H25N3O3/c1-2-20(15-6-4-3-5-7-15)17(22)14-16(21)18-8-9-19-10-12-23-13-11-19/h3-7H,2,8-14H2,1H3,(H,18,21) |
| InChIKey | BUENOENCPAFJDP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|