About S-trityl 2-morpholin-4-ylethanethioate
S-trityl 2-morpholin-4-ylethanethioate (PubChem CID 15780363) has the molecular formula C25H25NO2S
and a molecular weight of 403.55 g/mol. Its IUPAC name is S-trityl 2-morpholin-4-ylethanethioate.
Molecular Properties
| Compound Name | S-trityl 2-morpholin-4-ylethanethioate |
| PubChem CID | 15780363 |
| Molecular Formula | C25H25NO2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | S-trityl 2-morpholin-4-ylethanethioate |
| SMILES | O=C(CN1CCOCC1)SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO2S/c27-24(20-26-16-18-28-19-17-26)29-25(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15H,16-20H2 |
| InChIKey | NQHGTRCDCSDSTA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze S-trityl 2-morpholin-4-ylethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-trityl 2-morpholin-4-ylethanethioate?
The IUPAC name of S-trityl 2-morpholin-4-ylethanethioate (CID 15780363) is S-trityl 2-morpholin-4-ylethanethioate.
What is the SMILES notation for S-trityl 2-morpholin-4-ylethanethioate?
The canonical SMILES for S-trityl 2-morpholin-4-ylethanethioate is O=C(CN1CCOCC1)SC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of S-trityl 2-morpholin-4-ylethanethioate?
The InChIKey is NQHGTRCDCSDSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO2S/c27-24(20-26-16-18-28-19-17-26)29-25(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15H,16-20H2.
What are the key properties of S-trityl 2-morpholin-4-ylethanethioate?
S-trityl 2-morpholin-4-ylethanethioate has a molecular weight of 403.55 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-trityl 2-morpholin-4-ylethanethioate is sourced from PubChem (CID 15780363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).