C28H32N2O2S — CID 126752612
2-[4-(3-tritylsulfanylpropyl)piperazin-1-yl]acetic acid (PubChem CID 126752612) has the molecular formula C28H32N2O2S and a molecular weight of 460.64 g/mol. Its IUPAC name is 2-[4-(3-tritylsulfanylpropyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(3-tritylsulfanylpropyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 126752612 |
| Molecular Formula | C28H32N2O2S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 2-[4-(3-tritylsulfanylpropyl)piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCCSC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H32N2O2S/c31-27(32)23-30-20-18-29(19-21-30)17-10-22-33-28(24-11-4-1-5-12-24,25-13-6-2-7-14-25)26-15-8-3-9-16-26/h1-9,11-16H,10,17-23H2,(H,31,32) |
| InChIKey | GNXHIRWGBJAJET-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|