C42H54GdN5O7S — CID 71533914
2-[4,7-bis(carboxylatomethyl)-10-[2-oxo-2-(7-tritylsulfanylheptylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) (PubChem CID 71533914) has the molecular formula C42H54GdN5O7S and a molecular weight of 930.24 g/mol. Its IUPAC name is 2-[4,7-bis(carboxylatomethyl)-10-[2-oxo-2-(7-tritylsulfanylheptylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+).
| Compound Name | 2-[4,7-bis(carboxylatomethyl)-10-[2-oxo-2-(7-tritylsulfanylheptylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
|---|---|
| PubChem CID | 71533914 |
| Molecular Formula | C42H54GdN5O7S |
| Molecular Weight | 930.24 g/mol |
| Exact Mass | 930.30 |
| IUPAC Name | 2-[4,7-bis(carboxylatomethyl)-10-[2-oxo-2-(7-tritylsulfanylheptylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
| SMILES | O=C([O-])CN1CCN(CC(=O)[O-])CCN(CC(=O)NCCCCCCCSC(c2ccccc2)(c2ccccc2)c2ccccc2)CCN(CC(=O)[O-])CC1.[Gd+3] |
| InChI | InChI=1S/C42H57N5O7S.Gd/c48-38(31-44-22-24-45(32-39(49)50)26-28-47(34-41(53)54)29-27-46(25-23-44)33-40(51)52)43-21-13-2-1-3-14-30-55-42(35-15-7-4-8-16-35,36-17-9-5-10-18-36)37-19-11-6-12-20-37;/h4-12,15-20H,1-3,13-14,21-34H2,(H,43,48)(H,49,50)(H,51,52)(H,53,54);/q;+3/p-3 |
| InChIKey | RHOPCPSBNLBDTO-UHFFFAOYSA-K |
| XLogP | 0.25 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|