C25H32F3N5O2 — CID 30964057
N-[3-(N-methylanilino)propyl]-2-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]piperazin-1-yl]acetamide (PubChem CID 30964057) has the molecular formula C25H32F3N5O2 and a molecular weight of 491.56 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-2-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]piperazin-1-yl]acetamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-2-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30964057 |
| Molecular Formula | C25H32F3N5O2 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-2-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]piperazin-1-yl]acetamide |
| SMILES | CN(CCCNC(=O)CN1CCN(CC(=O)Nc2ccccc2C(F)(F)F)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H32F3N5O2/c1-31(20-8-3-2-4-9-20)13-7-12-29-23(34)18-32-14-16-33(17-15-32)19-24(35)30-22-11-6-5-10-21(22)25(26,27)28/h2-6,8-11H,7,12-19H2,1H3,(H,29,34)(H,30,35) |
| InChIKey | ZKIKQWAEOCYNIW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|