C36H48N4O6P+ — CID 24864827
triphenyl-[4-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butyl]phosphanium (PubChem CID 24864827) has the molecular formula C36H48N4O6P+ and a molecular weight of 663.78 g/mol. Its IUPAC name is triphenyl-[4-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butyl]phosphanium.
| Compound Name | triphenyl-[4-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butyl]phosphanium |
|---|---|
| PubChem CID | 24864827 |
| Molecular Formula | C36H48N4O6P+ |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.33 |
| IUPAC Name | triphenyl-[4-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butyl]phosphanium |
| SMILES | O=C(O)CN1CCN(CCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C36H47N4O6P/c41-34(42)28-38-21-19-37(20-22-39(29-35(43)44)24-26-40(25-23-38)30-36(45)46)18-10-11-27-47(31-12-4-1-5-13-31,32-14-6-2-7-15-32)33-16-8-3-9-17-33/h1-9,12-17H,10-11,18-30H2,(H2-,41,42,43,44,45,46)/p+1 |
| InChIKey | ZFWAWHVYPYMDRV-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|