About bromomethane;6-carboxyhexyl(triphenyl)phosphanium
bromomethane;6-carboxyhexyl(triphenyl)phosphanium (PubChem CID 177012688) has the molecular formula C26H31BrO2P+
and a molecular weight of 486.41 g/mol. Its IUPAC name is bromomethane;6-carboxyhexyl(triphenyl)phosphanium.
Molecular Properties
| Compound Name | bromomethane;6-carboxyhexyl(triphenyl)phosphanium |
| PubChem CID | 177012688 |
| Molecular Formula | C26H31BrO2P+ |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | bromomethane;6-carboxyhexyl(triphenyl)phosphanium |
| SMILES | CBr.O=C(O)CCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27O2P.CH3Br/c26-25(27)20-12-1-2-13-21-28(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24;1-2/h3-11,14-19H,1-2,12-13,20-21H2;1H3/p+1 |
| InChIKey | DTEPRHKAKARNCZ-UHFFFAOYSA-O |
| XLogP | 6.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;6-carboxyhexyl(triphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;6-carboxyhexyl(triphenyl)phosphanium?
The IUPAC name of bromomethane;6-carboxyhexyl(triphenyl)phosphanium (CID 177012688) is bromomethane;6-carboxyhexyl(triphenyl)phosphanium.
What is the SMILES notation for bromomethane;6-carboxyhexyl(triphenyl)phosphanium?
The canonical SMILES for bromomethane;6-carboxyhexyl(triphenyl)phosphanium is CBr.O=C(O)CCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of bromomethane;6-carboxyhexyl(triphenyl)phosphanium?
The InChIKey is DTEPRHKAKARNCZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H27O2P.CH3Br/c26-25(27)20-12-1-2-13-21-28(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24;1-2/h3-11,14-19H,1-2,12-13,20-21H2;1H3/p+1.
What are the key properties of bromomethane;6-carboxyhexyl(triphenyl)phosphanium?
bromomethane;6-carboxyhexyl(triphenyl)phosphanium has a molecular weight of 486.41 g/mol, XLogP of 6.03, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;6-carboxyhexyl(triphenyl)phosphanium is sourced from PubChem (CID 177012688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).