About 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide
2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide (PubChem CID 102601236) has the molecular formula C21H20Br3O2P
and a molecular weight of 575.08 g/mol. Its IUPAC name is 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide.
Molecular Properties
| Compound Name | 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide |
| PubChem CID | 102601236 |
| Molecular Formula | C21H20Br3O2P |
| Molecular Weight | 575.08 g/mol |
| Exact Mass | 571.88 |
| IUPAC Name | 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide |
| SMILES | BrBr.O=C(O)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C21H19O2P.Br2.BrH/c22-21(23)16-17-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;1-2;/h1-15H,16-17H2;;1H |
| InChIKey | UWXWGCUVIHGBLD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 575.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide?
The IUPAC name of 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide (CID 102601236) is 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide.
What is the SMILES notation for 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide?
The canonical SMILES for 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide is BrBr.O=C(O)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-].
What is the InChIKey of 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide?
The InChIKey is UWXWGCUVIHGBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19O2P.Br2.BrH/c22-21(23)16-17-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;1-2;/h1-15H,16-17H2;;1H.
What are the key properties of 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide?
2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide has a molecular weight of 575.08 g/mol, XLogP of 2.15, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyethyl(triphenyl)phosphanium;molecular bromine;bromide is sourced from PubChem (CID 102601236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).