C25H29BrN3OP — CID 167553273
[6-(diaminomethylideneamino)-3-oxohexyl]-triphenylphosphanium bromide (PubChem CID 167553273) has the molecular formula C25H29BrN3OP and a molecular weight of 498.41 g/mol. Its IUPAC name is [6-(diaminomethylideneamino)-3-oxohexyl]-triphenylphosphanium bromide.
| Compound Name | [6-(diaminomethylideneamino)-3-oxohexyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 167553273 |
| Molecular Formula | C25H29BrN3OP |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [6-(diaminomethylideneamino)-3-oxohexyl]-triphenylphosphanium bromide |
| SMILES | NC(N)=NCCCC(=O)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C25H29N3OP.BrH/c26-25(27)28-19-10-11-21(29)18-20-30(22-12-4-1-5-13-22,23-14-6-2-7-15-23)24-16-8-3-9-17-24;/h1-9,12-17H,10-11,18-20H2,(H4,26,27,28);1H/q+1;/p-1 |
| InChIKey | FCZUWQYJHCXSNB-UHFFFAOYSA-M |
| XLogP | -0.00 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|