C23H24NO3P — CID 139243684
(3-amino-3-oxopropyl)-triphenylphosphanium acetate (PubChem CID 139243684) has the molecular formula C23H24NO3P and a molecular weight of 393.42 g/mol. Its IUPAC name is (3-amino-3-oxopropyl)-triphenylphosphanium acetate.
| Compound Name | (3-amino-3-oxopropyl)-triphenylphosphanium acetate |
|---|---|
| PubChem CID | 139243684 |
| Molecular Formula | C23H24NO3P |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (3-amino-3-oxopropyl)-triphenylphosphanium acetate |
| SMILES | CC(=O)[O-].NC(=O)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20NOP.C2H4O2/c22-21(23)16-17-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;1-2(3)4/h1-15H,16-17H2,(H-,22,23);1H3,(H,3,4) |
| InChIKey | CGLFNAVHBBNFCG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|