C12H19BN4O3 — CID 134142089
[(1R)-1-benzamido-4-(diaminomethylideneamino)butyl]boronic acid (PubChem CID 134142089) has the molecular formula C12H19BN4O3 and a molecular weight of 278.12 g/mol. Its IUPAC name is [(1R)-1-benzamido-4-(diaminomethylideneamino)butyl]boronic acid.
| Compound Name | [(1R)-1-benzamido-4-(diaminomethylideneamino)butyl]boronic acid |
|---|---|
| PubChem CID | 134142089 |
| Molecular Formula | C12H19BN4O3 |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [(1R)-1-benzamido-4-(diaminomethylideneamino)butyl]boronic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1ccccc1)B(O)O |
| InChI | InChI=1S/C12H19BN4O3/c14-12(15)16-8-4-7-10(13(19)20)17-11(18)9-5-2-1-3-6-9/h1-3,5-6,10,19-20H,4,7-8H2,(H,17,18)(H4,14,15,16)/t10-/m0/s1 |
| InChIKey | VIPWDNZGGXPWPZ-JTQLQIEISA-N |
| XLogP | -1.15 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|