C20H32BN5O4 — CID 152750309
[(1R)-4-(diaminomethylideneamino)-1-[[1-(1-phenylethylcarbamoyl)cyclopentanecarbonyl]amino]butyl]boronic acid (PubChem CID 152750309) has the molecular formula C20H32BN5O4 and a molecular weight of 417.32 g/mol. Its IUPAC name is [(1R)-4-(diaminomethylideneamino)-1-[[1-(1-phenylethylcarbamoyl)cyclopentanecarbonyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-4-(diaminomethylideneamino)-1-[[1-(1-phenylethylcarbamoyl)cyclopentanecarbonyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 152750309 |
| Molecular Formula | C20H32BN5O4 |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | [(1R)-4-(diaminomethylideneamino)-1-[[1-(1-phenylethylcarbamoyl)cyclopentanecarbonyl]amino]butyl]boronic acid |
| SMILES | CC(NC(=O)C1(C(=O)N[C@@H](CCCN=C(N)N)B(O)O)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H32BN5O4/c1-14(15-8-3-2-4-9-15)25-17(27)20(11-5-6-12-20)18(28)26-16(21(29)30)10-7-13-24-19(22)23/h2-4,8-9,14,16,29-30H,5-7,10-13H2,1H3,(H,25,27)(H,26,28)(H4,22,23,24)/t14?,16-/m0/s1 |
| InChIKey | VEZAMJJZNIRGKL-WMCAAGNKSA-N |
| XLogP | -0.03 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|