C22H36BClN4O4 — CID 18665501
[(1R)-4-(diaminomethylideneamino)-1-[[4-(4-ethoxy-1-bicyclo[2.2.2]octanyl)benzoyl]amino]butyl]boronic acid;hydrochloride (PubChem CID 18665501) has the molecular formula C22H36BClN4O4 and a molecular weight of 466.82 g/mol. Its IUPAC name is [(1R)-4-(diaminomethylideneamino)-1-[[4-(4-ethoxy-1-bicyclo[2.2.2]octanyl)benzoyl]amino]butyl]boronic acid;hydrochloride.
| Compound Name | [(1R)-4-(diaminomethylideneamino)-1-[[4-(4-ethoxy-1-bicyclo[2.2.2]octanyl)benzoyl]amino]butyl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 18665501 |
| Molecular Formula | C22H36BClN4O4 |
| Molecular Weight | 466.82 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | [(1R)-4-(diaminomethylideneamino)-1-[[4-(4-ethoxy-1-bicyclo[2.2.2]octanyl)benzoyl]amino]butyl]boronic acid;hydrochloride |
| SMILES | CCOC12CCC(c3ccc(C(=O)N[C@@H](CCCN=C(N)N)B(O)O)cc3)(CC1)CC2.Cl |
| InChI | InChI=1S/C22H35BN4O4.ClH/c1-2-31-22-12-9-21(10-13-22,11-14-22)17-7-5-16(6-8-17)19(28)27-18(23(29)30)4-3-15-26-20(24)25;/h5-8,18,29-30H,2-4,9-15H2,1H3,(H,27,28)(H4,24,25,26);1H/t18-,21?,22?;/m0./s1 |
| InChIKey | LAVOVQQOIWTHPF-JEYCRDNMSA-N |
| XLogP | 1.65 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.82 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|