C17H19BBrNO3 — CID 67705375
[4-bromo-1-[(4-phenylbenzoyl)amino]butyl]boronic acid (PubChem CID 67705375) has the molecular formula C17H19BBrNO3 and a molecular weight of 376.06 g/mol. Its IUPAC name is [4-bromo-1-[(4-phenylbenzoyl)amino]butyl]boronic acid.
| Compound Name | [4-bromo-1-[(4-phenylbenzoyl)amino]butyl]boronic acid |
|---|---|
| PubChem CID | 67705375 |
| Molecular Formula | C17H19BBrNO3 |
| Molecular Weight | 376.06 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | [4-bromo-1-[(4-phenylbenzoyl)amino]butyl]boronic acid |
| SMILES | O=C(NC(CCCBr)B(O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19BBrNO3/c19-12-4-7-16(18(22)23)20-17(21)15-10-8-14(9-11-15)13-5-2-1-3-6-13/h1-3,5-6,8-11,16,22-23H,4,7,12H2,(H,20,21) |
| InChIKey | LASKCGIBMWUBOP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.06 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|