C27H36BN5O4 — CID 70273105
[(1R)-4-(diaminomethylideneamino)-1-[[1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)cyclopentanecarbonyl]amino]butyl]boronic acid (PubChem CID 70273105) has the molecular formula C27H36BN5O4 and a molecular weight of 505.43 g/mol. Its IUPAC name is [(1R)-4-(diaminomethylideneamino)-1-[[1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)cyclopentanecarbonyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-4-(diaminomethylideneamino)-1-[[1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)cyclopentanecarbonyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 70273105 |
| Molecular Formula | C27H36BN5O4 |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | [(1R)-4-(diaminomethylideneamino)-1-[[1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)cyclopentanecarbonyl]amino]butyl]boronic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)C1(C(=O)NC2c3ccccc3CCc3ccccc32)CCCC1)B(O)O |
| InChI | InChI=1S/C27H36BN5O4/c29-26(30)31-17-7-12-22(28(36)37)32-24(34)27(15-5-6-16-27)25(35)33-23-20-10-3-1-8-18(20)13-14-19-9-2-4-11-21(19)23/h1-4,8-11,22-23,36-37H,5-7,12-17H2,(H,32,34)(H,33,35)(H4,29,30,31)/t22-/m0/s1 |
| InChIKey | VRFNSXDTDDYYJX-QFIPXVFZSA-N |
| XLogP | 1.10 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|