C14H24Cl2N4 — CID 19036733
2-[4-(2,3-dihydro-1H-inden-1-ylamino)butyl]guanidine;dihydrochloride (PubChem CID 19036733) has the molecular formula C14H24Cl2N4 and a molecular weight of 319.28 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1H-inden-1-ylamino)butyl]guanidine;dihydrochloride.
| Compound Name | 2-[4-(2,3-dihydro-1H-inden-1-ylamino)butyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 19036733 |
| Molecular Formula | C14H24Cl2N4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-[4-(2,3-dihydro-1H-inden-1-ylamino)butyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NCCCCNC1CCc2ccccc21 |
| InChI | InChI=1S/C14H22N4.2ClH/c15-14(16)18-10-4-3-9-17-13-8-7-11-5-1-2-6-12(11)13;;/h1-2,5-6,13,17H,3-4,7-10H2,(H4,15,16,18);2*1H |
| InChIKey | FVMBQMUKROQABF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|