C18H22N2O — CID 102553129
1-[4-(2,3-dihydro-1H-inden-1-ylamino)butyl]pyridin-2-one (PubChem CID 102553129) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1H-inden-1-ylamino)butyl]pyridin-2-one.
| Compound Name | 1-[4-(2,3-dihydro-1H-inden-1-ylamino)butyl]pyridin-2-one |
|---|---|
| PubChem CID | 102553129 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[4-(2,3-dihydro-1H-inden-1-ylamino)butyl]pyridin-2-one |
| SMILES | O=c1ccccn1CCCCNC1CCc2ccccc21 |
| InChI | InChI=1S/C18H22N2O/c21-18-9-3-5-13-20(18)14-6-4-12-19-17-11-10-15-7-1-2-8-16(15)17/h1-3,5,7-9,13,17,19H,4,6,10-12,14H2 |
| InChIKey | KAVZEPOVAFMTBY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|