C21H26N2O2 — CID 97230967
1-[4-[[(4R)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butyl]pyridin-2-one (PubChem CID 97230967) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[4-[[(4R)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butyl]pyridin-2-one.
| Compound Name | 1-[4-[[(4R)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butyl]pyridin-2-one |
|---|---|
| PubChem CID | 97230967 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[4-[[(4R)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butyl]pyridin-2-one |
| SMILES | O=c1ccccn1CCCCN[C@@H]1CC2(CCC2)Oc2ccccc21 |
| InChI | InChI=1S/C21H26N2O2/c24-20-10-3-5-14-23(20)15-6-4-13-22-18-16-21(11-7-12-21)25-19-9-2-1-8-17(18)19/h1-3,5,8-10,14,18,22H,4,6-7,11-13,15-16H2/t18-/m1/s1 |
| InChIKey | LHVRKKYXHTVTSK-GOSISDBHSA-N |
| XLogP | 3.66 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|