C26H37BClN5O4 — CID 10324705
[(1R)-4-(diaminomethylideneamino)-1-[[2-[(1-phenylcyclopropyl)methyl-(3-phenylpropanoyl)amino]acetyl]amino]butyl]boronic acid;hydrochloride (PubChem CID 10324705) has the molecular formula C26H37BClN5O4 and a molecular weight of 529.88 g/mol. Its IUPAC name is [(1R)-4-(diaminomethylideneamino)-1-[[2-[(1-phenylcyclopropyl)methyl-(3-phenylpropanoyl)amino]acetyl]amino]butyl]boronic acid;hydrochloride.
| Compound Name | [(1R)-4-(diaminomethylideneamino)-1-[[2-[(1-phenylcyclopropyl)methyl-(3-phenylpropanoyl)amino]acetyl]amino]butyl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 10324705 |
| Molecular Formula | C26H37BClN5O4 |
| Molecular Weight | 529.88 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | [(1R)-4-(diaminomethylideneamino)-1-[[2-[(1-phenylcyclopropyl)methyl-(3-phenylpropanoyl)amino]acetyl]amino]butyl]boronic acid;hydrochloride |
| SMILES | Cl.NC(N)=NCCC[C@H](NC(=O)CN(CC1(c2ccccc2)CC1)C(=O)CCc1ccccc1)B(O)O |
| InChI | InChI=1S/C26H36BN5O4.ClH/c28-25(29)30-17-7-12-22(27(35)36)31-23(33)18-32(24(34)14-13-20-8-3-1-4-9-20)19-26(15-16-26)21-10-5-2-6-11-21;/h1-6,8-11,22,35-36H,7,12-19H2,(H,31,33)(H4,28,29,30);1H/t22-;/m0./s1 |
| InChIKey | LUKZTNOEGDWUJU-FTBISJDPSA-N |
| XLogP | 1.15 |
| TPSA | 154.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.88 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|