C12H25BN6O6 — CID 42611101
(4S)-4-amino-5-[[2-[[(1R)-1-borono-4-(diaminomethylideneamino)butyl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid (PubChem CID 42611101) has the molecular formula C12H25BN6O6 and a molecular weight of 360.18 g/mol. Its IUPAC name is (4S)-4-amino-5-[[2-[[(1R)-1-borono-4-(diaminomethylideneamino)butyl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[2-[[(1R)-1-borono-4-(diaminomethylideneamino)butyl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 42611101 |
| Molecular Formula | C12H25BN6O6 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (4S)-4-amino-5-[[2-[[(1R)-1-borono-4-(diaminomethylideneamino)butyl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)CNC(=O)[C@@H](N)CCC(=O)O)B(O)O |
| InChI | InChI=1S/C12H25BN6O6/c14-7(3-4-10(21)22)11(23)18-6-9(20)19-8(13(24)25)2-1-5-17-12(15)16/h7-8,24-25H,1-6,14H2,(H,18,23)(H,19,20)(H,21,22)(H4,15,16,17)/t7-,8-/m0/s1 |
| InChIKey | GQBSIHSJWRJYKH-YUMQZZPRSA-N |
| XLogP | -4.15 |
| TPSA | 226.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|