C21H33BCl2N4O3 — CID 18665497
[(1R)-1-[[4-(4-chloro-1-bicyclo[2.2.2]octanyl)benzoyl]amino]-5-(diaminomethylideneamino)pentyl]boronic acid;hydrochloride (PubChem CID 18665497) has the molecular formula C21H33BCl2N4O3 and a molecular weight of 471.24 g/mol. Its IUPAC name is [(1R)-1-[[4-(4-chloro-1-bicyclo[2.2.2]octanyl)benzoyl]amino]-5-(diaminomethylideneamino)pentyl]boronic acid;hydrochloride.
| Compound Name | [(1R)-1-[[4-(4-chloro-1-bicyclo[2.2.2]octanyl)benzoyl]amino]-5-(diaminomethylideneamino)pentyl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 18665497 |
| Molecular Formula | C21H33BCl2N4O3 |
| Molecular Weight | 471.24 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | [(1R)-1-[[4-(4-chloro-1-bicyclo[2.2.2]octanyl)benzoyl]amino]-5-(diaminomethylideneamino)pentyl]boronic acid;hydrochloride |
| SMILES | Cl.NC(N)=NCCCC[C@H](NC(=O)c1ccc(C23CCC(Cl)(CC2)CC3)cc1)B(O)O |
| InChI | InChI=1S/C21H32BClN4O3.ClH/c23-21-11-8-20(9-12-21,10-13-21)16-6-4-15(5-7-16)18(28)27-17(22(29)30)3-1-2-14-26-19(24)25;/h4-7,17,29-30H,1-3,8-14H2,(H,27,28)(H4,24,25,26);1H/t17-,20?,21?;/m0./s1 |
| InChIKey | PZHUDKSYKXKZQR-HVRUQFDTSA-N |
| XLogP | 2.25 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|