C26H30O2P+ — CID 10345272
(6-ethoxy-6-oxohexyl)-triphenylphosphanium (PubChem CID 10345272) has the molecular formula C26H30O2P+ and a molecular weight of 405.50 g/mol. Its IUPAC name is (6-ethoxy-6-oxohexyl)-triphenylphosphanium.
| Compound Name | (6-ethoxy-6-oxohexyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 10345272 |
| Molecular Formula | C26H30O2P+ |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (6-ethoxy-6-oxohexyl)-triphenylphosphanium |
| SMILES | CCOC(=O)CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30O2P/c1-2-28-26(27)21-13-6-14-22-29(23-15-7-3-8-16-23,24-17-9-4-10-18-24)25-19-11-5-12-20-25/h3-5,7-12,15-20H,2,6,13-14,21-22H2,1H3/q+1 |
| InChIKey | ZTAVLFUUIFGECS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|