C28H34BrO2P — CID 133061652
(6-butan-2-yloxy-6-oxohexyl)-triphenylphosphanium bromide (PubChem CID 133061652) has the molecular formula C28H34BrO2P and a molecular weight of 513.46 g/mol. Its IUPAC name is (6-butan-2-yloxy-6-oxohexyl)-triphenylphosphanium bromide.
| Compound Name | (6-butan-2-yloxy-6-oxohexyl)-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 133061652 |
| Molecular Formula | C28H34BrO2P |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (6-butan-2-yloxy-6-oxohexyl)-triphenylphosphanium bromide |
| SMILES | CCC(C)OC(=O)CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C28H34O2P.BrH/c1-3-24(2)30-28(29)22-14-7-15-23-31(25-16-8-4-9-17-25,26-18-10-5-11-19-26)27-20-12-6-13-21-27;/h4-6,8-13,16-21,24H,3,7,14-15,22-23H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | JPWODXXRMFTWKA-UHFFFAOYSA-M |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|