C16H23N3O3 — CID 134069440
3-[4-[2-(N-methylanilino)-2-oxoethyl]piperazin-1-yl]propanoic acid (PubChem CID 134069440) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-[4-[2-(N-methylanilino)-2-oxoethyl]piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-[2-(N-methylanilino)-2-oxoethyl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 134069440 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-[4-[2-(N-methylanilino)-2-oxoethyl]piperazin-1-yl]propanoic acid |
| SMILES | CN(C(=O)CN1CCN(CCC(=O)O)CC1)c1ccccc1 |
| InChI | InChI=1S/C16H23N3O3/c1-17(14-5-3-2-4-6-14)15(20)13-19-11-9-18(10-12-19)8-7-16(21)22/h2-6H,7-13H2,1H3,(H,21,22) |
| InChIKey | SRBSJXDSILLEJN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |