C15H22N2O — CID 110688340
N-methyl-N-phenyl-3-piperidin-1-ylpropanamide (PubChem CID 110688340) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N-methyl-N-phenyl-3-piperidin-1-ylpropanamide.
| Compound Name | N-methyl-N-phenyl-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 110688340 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-methyl-N-phenyl-3-piperidin-1-ylpropanamide |
| SMILES | CN(C(=O)CCN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O/c1-16(14-8-4-2-5-9-14)15(18)10-13-17-11-6-3-7-12-17/h2,4-5,8-9H,3,6-7,10-13H2,1H3 |
| InChIKey | CUIPZAHRPHJZLW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |