C14H18N2O3 — CID 110856938
N-methyl-3-(2-oxo-1,3-oxazinan-3-yl)-N-phenylpropanamide (PubChem CID 110856938) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-methyl-3-(2-oxo-1,3-oxazinan-3-yl)-N-phenylpropanamide.
| Compound Name | N-methyl-3-(2-oxo-1,3-oxazinan-3-yl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 110856938 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-methyl-3-(2-oxo-1,3-oxazinan-3-yl)-N-phenylpropanamide |
| SMILES | CN(C(=O)CCN1CCCOC1=O)c1ccccc1 |
| InChI | InChI=1S/C14H18N2O3/c1-15(12-6-3-2-4-7-12)13(17)8-10-16-9-5-11-19-14(16)18/h2-4,6-7H,5,8-11H2,1H3 |
| InChIKey | MMTBMQFWMDQMEW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |