C38H58N10O12 — CID 71491951
2-[4,7-bis(carboxymethyl)-10-[[3-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]quinoxalin-2-yl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 71491951) has the molecular formula C38H58N10O12 and a molecular weight of 846.94 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[[3-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]quinoxalin-2-yl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[[3-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]quinoxalin-2-yl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 71491951 |
| Molecular Formula | C38H58N10O12 |
| Molecular Weight | 846.94 g/mol |
| Exact Mass | 846.42 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[[3-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]quinoxalin-2-yl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(Cc2nc3ccccc3nc2CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C38H58N10O12/c49-33(50)23-43-9-5-41(6-10-44(24-34(51)52)14-18-47(17-13-43)27-37(57)58)21-31-32(40-30-4-2-1-3-29(30)39-31)22-42-7-11-45(25-35(53)54)15-19-48(28-38(59)60)20-16-46(12-8-42)26-36(55)56/h1-4H,5-28H2,(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60) |
| InChIKey | IXWBHKGQCRGFRG-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 275.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.94 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |